1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate

Catalog Number	ACM263163173-1
CAS	263163-17-3
Structure
Synonyms	1,3-Bis(tert-butyl)-imidazol-2-ylidinium tetrafluoroborate, N,N'-Bis(tert-butyl)imidazolium tetrafluoroborate
IUPAC Name	1,3-ditert-butylimidazol-1-ium;tetrafluoroborate
Molecular Weight	268.10
Molecular Formula	C11H21BF4N2
InChI	OOFLHRYFPBGTPQ-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H21N2.BF4/c1-10(2,3)12-7-8-13(9-12)11(4,5)6;2-1(3,4)5/h7-9H,1-6H3;/q+1;-1
Melting Point	157-198 °C
Purity	98%
Appearance	Beige solid
Isomeric SMILES	[B-](F)(F)(F)F.CC(C)(C)N1C=C[N+](=C1)C(C)(C)C

Q&A

What is the product name of CAS:263163-17-3?

The product name is 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate.

What is the molecular weight of 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate?

The molecular weight is 268.104.

What are the product categories that 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate belongs to?

It belongs to Achiral Nitrogen, NHC, Ligands, N-Heterocyclic Carbene Ligands, Synthetic Organic Chemistry, and organic amine categories.

What is the melting point of 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate?

The melting point is 157-198 °C.

How should 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the color of 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate?

The color is white to cream-colored.

What are the hazard codes associated with 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate?

The hazard code is Xi.

What are the safety statements for using 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate?

The safety statements are 26-36.

What is the hazard class of 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate?

The hazard class is 8.

What are the uses of 1,3-Di-tert-butyl-1H-imidazol-3-ium tetrafluoroborate?

It may be used in the preparation of di-μ-iodobis(1,3-di-tert-butylimidazolin-2-ylidene)diiododipalladium(II), a palladium(II)-NHC complex, which can catalyze Mizoroki-Heck reaction.