1,3-Di(1-adamantyl)imidazolinium Tetrafluoroborate

Catalog Number	ACM1176202633-3
CAS	1176202-63-3
Structure
Synonyms	SCHEMBL1078610; CTK4B0351; I14-93977; AKOS015832933; 1,3-Bis(1-adamantyl)imidazolinium tetrafluoroborate; ACMC-2099up; DTXSID30718742; 1176202-63-3;
IUPAC Name	1,3-bis(1-adamantyl)imidazolidin-1-ium;tetrafluoroborate;
Molecular Weight	426.34
Molecular Formula	C23H35BF4N2
Canonical SMILES	[B-](F)(F)(F)F.C1CN(C[NH+]1C23CC4CC(C2)CC(C4)C3)C56CC7CC(C5)CC(C7)C6;
InChI	InChI=1S/C23H36N2.BF4/c1-2-25(23-12-19-6-20(13-23)8-21(7-19)14-23)15-24(1)22-9-16-3-17(10-22)5-18(4-16)11-22;2-1(3,4)5/h16-21H,1-15H2;/q;-1/p+1;
InChI Key	AFLPPSBVXPAHAH-UHFFFAOYSA-O;
Purity	98%
Appearance	Solid
Complexity	517
Covalently-Bonded Unit Count	2
Exact Mass	428.299g/mol
Heavy Atom Count	30
Monoisotopic Mass	428.299g/mol
Rotatable Bond Count	2
Topological Polar Surface Area	7.7A^2

Q&A

What is the chemical formula of (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?

The chemical formula is C44H32P2.

What is the melting point of (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?

The melting point is 283-286 °C.

What is the solubility of this compound in water?

It is insoluble in water.

What is the optical activity of (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?

The optical activity is [α]20/D +222°, c = 0.5% in benzene.

What is the hazard code associated with this compound?

The hazard codes are Xi and Xn.

What is the use of (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl as a ligand?

It is a chiral ligand for metal-mediated asymmetric catalysis.

In which reaction can (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl be combined with dichloro(1,5-cyclooctadiene)ruthenium?

It can be combined to form precursors to NOYORI CATALYST SYSTEMS.

What color is (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?

It is white to cream-white in color.

What are some product categories that (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl belongs to?

It belongs to categories like asymmetric synthesis, phosphine ligands, and synthetic organic chemistry.

What is another name for (R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl?

Another name for it is (R)-(+)-BINAP.