ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,3-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)benzene

Catalog Number ACM131380864
CAS 131380-86-4
Structure {[CurrentData.Name]}
Synonyms 1,3-Bis[(4S)-4beta-[(S)-Sec-Butyl]-2-Oxazoline-2-Yl]Benzene; (4S)-4-[(2S)-Butan-2-yl]-2-[3-[(4S)-4-[(2S)-butan-2-yl]-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4,5-dihydro-1,3-oxazole
IUPAC Name (4S)-4-[(2S)-butan-2-yl]-2-[3-[(4S)-4-[(2S)-butan-2-yl]-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4,5-dihydro-1,3-oxazole
Molecular Weight 328.45
Molecular Formula C20H28N2O2
InChI PZPUGMDGPIPICI-LBTBCDHLSA-N
InChI Key InChI=1S/C20H28N2O2/c1-5-13(3)17-11-23-19(21-17)15-8-7-9-16(10-15)20-22-18(12-24-20)14(4)6-2/h7-10,13-14,17-18H,5-6,11-12H2,1-4H3/t13-,14-,17+,18+/m0/s1
Purity 98%
Isomeric SMILES CC[C@H](C)[C@H]1COC(=N1)C2=CC(=CC=C2)C3=N[C@H](CO3)[C@@H](C)CC
Q&A

What is the CAS number of the compound 1,3-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)benzene?

The CAS number is 131380-86-4.

What is the molecular weight of 1,3-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)benzene?

The molecular weight is 328.46 g/mol.

What is the predicted boiling point of the compound?

The predicted boiling point is 463.5±28.0 °C.

What is the predicted pKa value of 1,3-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)benzene?

The predicted pKa value is 4.85±0.70.

What is the predicted density of the compound?

The predicted density is 1.14±0.1 g/cm3.

Are there any synonyms for 1,3-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)benzene?

Yes, one of the synonyms is Oxazole, 2,2'-(1,3-phenylene)bis[4,5-dihydro-4-[(1S)-1-methylpropyl]-, (4S,4'S)-.

What is the molecular formula of the compound?

The molecular formula is C20H28N2O2.

What are the stereochemical configurations of the compound?

The compound has the stereochemical configurations (4S,4'S).

How is the compound named structurally?

The compound is named as 1,3-Bis((S)-4-((S)-sec-butyl)-4,5-dihydrooxazol-2-yl)benzene.

What functional groups are present in the compound?

The compound contains oxazole and benzene functional groups.

Please kindly note that our products and services are for research use only.