ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,3-Bis(Phenylphosphino)propane

Catalog Number ACM28240666-1
CAS 28240-66-6
Structure {[CurrentData.Name]}
Synonyms Phenyl(3-Phenylphosphanylpropyl)Phosphane; 1,3-Diphenylphosphino Propane
IUPAC Name phenyl(3-phenylphosphanylpropyl)phosphane
Molecular Weight 260.25
Molecular Formula C15H18P2
InChI AVNRJUHUOZDFKS-UHFFFAOYSA-N
InChI Key InChI=1S/C15H18P2/c1-3-8-14(9-4-1)16-12-7-13-17-15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2
Boiling Point 160-165 °C at 1 mmHg
Flash Point 160-165 °C at 1mmHg
Purity 95%
Appearance Liquid
Isomeric SMILES C1=CC=C(C=C1)PCCCPC2=CC=CC=C2
Q&A

What is the IUPAC name of 1,3-Bis(Phenylphosphino)propane?

The IUPAC name is phenyl(3-phenylphosphanylpropyl)phosphane.

What are some of the depositor-supplied synonyms for 1,3-Bis(phenylphosphino)propane?

Some of the synonyms include 1,3-BIS(PHENYLPHOSPHINO)PROPANE, phenyl(3-phenylphosphanylpropyl)phosphane, and 1,3-diphenylphosphinopropane.

What is the CAS number of 1,3-Bis(phenylphosphino)propane?

The CAS number is 28240-66-6.

How many covalently-bonded units are present in 1,3-Bis(Phenylphosphino)propane?

There is 1 covalently-bonded unit.

What is the molecular weight of 1,3-Bis(phenylphosphino)propane?

The molecular weight is 260.25g/mol.

Does 1,3-Bis(Phenylphosphino)propane have any defined atom stereocenter count?

No, 1,3-Bis(Phenylphosphino)propane has 0 defined atom stereocenter count.

What is the canonical SMILES representation of 1,3-Bis(Phenylphosphino)propane?

The canonical SMILES is C1=CC=C(C=C1)PCCCPC2=CC=CC=C2.

What is the topological polar surface area of 1,3-Bis(phenylphosphino)propane?

The topological polar surface area is 0.

What is the Exact Mass of 1,3-Bis(Phenylphosphino)propane?

The Exact Mass is 260.08837457.

Please kindly note that our products and services are for research use only.