Can you provide a Depositor-Supplied Synonym for 1,3-Bis(diphenylphosphino)propane nickel(II) chloride?
One of the Depositor-Supplied Synonyms for 1,3-Bis(diphenylphosphino)propane nickel(II) chloride is Ni(dppp)Cl2.
What is the European Community (EC) Number of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride?
The European Community (EC) Number of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride is 605-052-3.
How many heavy atoms are present in 1,3-Bis(diphenylphosphino)propane nickel(II) chloride?
There are 32 heavy atoms present in 1,3-Bis(diphenylphosphino)propane nickel(II) chloride.
What is the molecular weight of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride?
The molecular weight of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride is 542.0g/mol.
Can you provide the Canonical SMILES representation of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride?
The Canonical SMILES representation of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride is C1=CC=C(C=C1)P(CCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl[Ni]Cl.
What is the IUPAC Name of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride?
The IUPAC Name of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride is dichloronickel;3-diphenylphosphanylpropyl(diphenyl)phosphane.
How many rotatable bonds are present in 1,3-Bis(diphenylphosphino)propane nickel(II) chloride?
There are 8 rotatable bonds present in 1,3-Bis(diphenylphosphino)propane nickel(II) chloride.
What is the Exact Mass of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride?
The Exact Mass of 1,3-Bis(diphenylphosphino)propane nickel(II) chloride is 540.024022.