1,3-Bis(dimethylamino)benzene

Catalog Number	ACM22440933-1
CAS	22440-93-3
Structure
Synonyms	N,N,N',N'-Tetramethyl-m-phenylenediamine, N1,N1,N3,N3-Tetramethylbenzene-1,3-diamine
IUPAC Name	1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine
Molecular Weight	164.25
Molecular Formula	C10H16N2
InChI	LFZLVJBOEONQHV-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H16N2/c1-11(2)9-6-5-7-10(8-9)12(3)4/h5-8H,1-4H3
Purity	98%
Appearance	Colorless to light yellow liquid
Isomeric SMILES	CN(C)C1=CC(=CC=C1)N(C)C

Q&A

What is the molecular weight of 1,3-Bis(dimethylamino)benzene?

The molecular weight of 1,3-Bis(dimethylamino)benzene is 164.25.

What are the product categories that 1,3-Bis(dimethylamino)benzene belongs to?

1,3-Bis(dimethylamino)benzene belongs to Cy-N, Achiral Nitrogen, Amines, Building Blocks, C10, Chemical Synthesis, New Products for Chemical Synthesis, Nitrogen Compounds, and Organic Building Blocks.

What is the boiling point of 1,3-Bis(dimethylamino)benzene?

The boiling point of 1,3-Bis(dimethylamino)benzene is 140 °C (at 15 Torr).

How should 1,3-Bis(dimethylamino)benzene be stored?

1,3-Bis(dimethylamino)benzene should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the color of 1,3-Bis(dimethylamino)benzene?

1,3-Bis(dimethylamino)benzene is colorless.

What is the density of 1,3-Bis(dimethylamino)benzene at 25℃?

The density of 1,3-Bis(dimethylamino)benzene is 0.976g/ml at 25℃.

What is the EPA Substance Registry System number for 1,3-Bis(dimethylamino)benzene?

The EPA Substance Registry System number for 1,3-Bis(dimethylamino)benzene is 22440-93-3.

What are the hazard codes associated with 1,3-Bis(dimethylamino)benzene?

The hazard code for 1,3-Bis(dimethylamino)benzene is T.

What safety statements are recommended for handling 1,3-Bis(dimethylamino)benzene?

Safety statements 26-36/37-45 are recommended for handling 1,3-Bis(dimethylamino)benzene.

What is the RIDADR classification for 1,3-Bis(dimethylamino)benzene?

The RIDADR classification for 1,3-Bis(dimethylamino)benzene is UN 2811 6.1/PGIII.