What is the molecular formula of 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
The molecular formula is C24H44P2.
What is the exact mass of 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
The exact mass is 394.29182540.
How many heavy atoms are present in the chemical structure of 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
There are 26 heavy atoms present.
What is the Canonical SMILES representation of 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
CC(C)(C)P(CC1=CC(=CC=C1)CP(C(C)(C)C)C(C)(C)C)C(C)(C)C
What is the CAS number of 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
The CAS number is 149968-36-5.
How many rotatable bonds are present in the chemical structure of 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
There are 8 rotatable bonds present.
What is the IUPAC name of 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
The IUPAC name is ditert-butyl-[[3-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane.
What is the InChIKey for 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
The InChIKey is VNLHPVUKSKTUPA-UHFFFAOYSA-N.
How many atom stereocenters are defined in the chemical structure of 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
There are no defined atom stereocenters.
What is the European Community (EC) Number for 1,3-Bis((di-tert-butylphosphino)methyl)benzene?
The European Community (EC) Number is 813-340-7.