1,3-Bis(benzo[d]oxazol-2-yl)benzene

Catalog Number	ACM59049842-1
CAS	59049-84-2
Structure
Synonyms	2,2-M-Phenylene-Bis-Benzoxazole; 2-[3-(1,3-Benzoxazol-2-Yl)Phenyl]-1,3-Benzoxazole
IUPAC Name	2-[3-(1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole
Molecular Weight	312.32
Molecular Formula	C20H12N2O2
InChI	RYDGJSHONGAQOS-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H12N2O2/c1-3-10-17-15(8-1)21-19(23-17)13-6-5-7-14(12-13)20-22-16-9-2-4-11-18(16)24-20/h1-12H
Boiling Point	458 °C at 760 mmHg
Purity	98%
Isomeric SMILES	C1=CC=C2C(=C1)N=C(O2)C3=CC(=CC=C3)C4=NC5=CC=CC=C5O4

Q&A

What is the CAS number for 1,3-Bis(benzo[d]oxazol-2-yl)benzene?

The CAS number for 1,3-Bis(benzo[d]oxazol-2-yl)benzene is 59049-84-2.

What is the molecular weight of 1,3-Bis(benzo[d]oxazol-2-yl)benzene?

The molecular weight of 1,3-Bis(benzo[d]oxazol-2-yl)benzene is 312.32.

What is the product name for 1,3-Bis(benzo[d]oxazol-2-yl)benzene?

The product name for 1,3-Bis(benzo[d]oxazol-2-yl)benzene is 2,2-m-pheylene-bis-benzoxazol.

What are some synonyms for 1,3-Bis(benzo[d]oxazol-2-yl)benzene?

Some synonyms for 1,3-Bis(benzo[d]oxazol-2-yl)benzene are 2,2'-(1,3-phenylene)bisBenzoxazole, 1,3-Di(benzo[d]oxazol-2-yl)benzene, Benzoxazole, 2,2'-(1,3-phenylene)bis-.

What is the molecular formula of 1,3-Bis(benzo[d]oxazol-2-yl)benzene?

The molecular formula of 1,3-Bis(benzo[d]oxazol-2-yl)benzene is C20H12N2O2.

How should 1,3-Bis(benzo[d]oxazol-2-yl)benzene be stored?

1,3-Bis(benzo[d]oxazol-2-yl)benzene should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What hazard class does 1,3-Bis(benzo[d]oxazol-2-yl)benzene belong to?

1,3-Bis(benzo[d]oxazol-2-yl)benzene belongs to the irritant hazard class.

How can 1,3-Bis(benzo[d]oxazol-2-yl)benzene cause harm?

1,3-Bis(benzo[d]oxazol-2-yl)benzene can cause harm by being an irritant.

What is the chemical structure of 1,3-Bis(benzo[d]oxazol-2-yl)benzene?

The chemical structure of 1,3-Bis(benzo[d]oxazol-2-yl)benzene consists of two benzoxazole rings attached to a central benzene ring.

What precautions should be taken when handling 1,3-Bis(benzo[d]oxazol-2-yl)benzene?

Precautions such as wearing protective gloves and eyewear should be taken when handling 1,3-Bis(benzo[d]oxazol-2-yl)benzene to prevent skin and eye irritation.