ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene

Catalog Number ACM1240037595
CAS 1240037-59-5
Synonyms 4-Ethyl-2-[3-(4-Ethyl-4,5-Dihydro-1,3-Oxazol-2-Yl)Phenyl]-4,5-Dihydro-1,3-Oxazole; Oxazole, 2,2'-(1,3-phenylene)bis[4-ethyl-4,5-dihydro-
IUPAC Name 4-ethyl-2-[3-(4-ethyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-4,5-dihydro-1,3-oxazole
Molecular Weight 272.34
Molecular Formula C16H20N2O2
InChI NRUCRBOQWHXVNO-UHFFFAOYSA-N
InChI Key InChI=1S/C16H20N2O2/c1-3-13-9-19-15(17-13)11-6-5-7-12(8-11)16-18-14(4-2)10-20-16/h5-8,13-14H,3-4,9-10H2,1-2H3
Purity 98%
Isomeric SMILES CCC1COC(=N1)C2=CC(=CC=C2)C3=NC(CO3)CC
Q&A

What is the chemical formula for 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

The chemical formula is C16H20N2O2.

What is the molecular weight of 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

The molecular weight is 272.34 g/mol.

What is another name for 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

Another name for it is Oxazole, 2,2'-(1,3-phenylene)bis[4-ethyl-4,5-dihydro-.

What is the predicted boiling point of 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

The predicted boiling point is 427.5±28.0 °C.

What is the predicted pka value of 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

The predicted pka value is 4.85±0.70.

What is the predicted density of 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

The predicted density is 1.20±0.1 g/cm3.

What are the synonyms for 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

The synonyms are Oxazole, 2,2'-(1,3-phenylene)bis[4-ethyl-4,5-dihydro-.

How many ethyl groups are present in the structure of 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

There are 2 ethyl groups present in the structure.

What is the predicted molecular weight of 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

The predicted molecular weight is 272.34 g/mol.

What is the CAS number for 1,3-Bis(4-ethyl-4,5-dihydrooxazol-2-yl)benzene?

The CAS number is 1240037-59-5.

Please kindly note that our products and services are for research use only.