1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride

Catalog Number	ACM136152266
CAS	136152-26-6
IUPAC Name	1,3,4-triphenyl-1,2,4-triazol-4-ium;chloride
Molecular Weight	333.81
Molecular Formula	C20H16ClN3
InChI	NULPPERJMQKORR-UHFFFAOYSA-M
InChI Key	InChI=1S/C20H16N3.ClH/c1-4-10-17(11-5-1)20-21-23(19-14-8-3-9-15-19)16-22(20)18-12-6-2-7-13-18;/h1-16H;1H/q+1;/p-1
Purity	97%
Isomeric SMILES	C1=CC=C(C=C1)C2=NN(C=[N+]2C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]

Q&A

What is the CAS number of 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride?

The CAS number is 136152-26-6.

What is the molecular weight of 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride?

The molecular weight is 333.82.

What is another name for 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride?

It is also known as 1,3,4-triphenyl-4H-1,2,4-triazol-1-iuM chloride.

What is the chemical formula of 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride?

The chemical formula is C20H16ClN3.

What are the synonyms for 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride?

The synonyms are 1,3,4-triphenyl-4H-1,2,4-triazol-1-iuM chloride and 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride.

Is 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride a chloride salt?

Yes, it contains a chloride ion.

What is the molecular formula of 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride?

The molecular formula is C20H16ClN3.

How many chlorine atoms are present in 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride?

There is one chlorine atom in the compound.

What is the structure of 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride?

It contains a triphenyltriazolium cation with a chloride anion.

What is the significance of 1,3,4-Triphenyl-1H-1,2,4-triazol-4-ium chloride?

It may have applications in various fields such as chemistry, materials science, or pharmaceuticals.