ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1-(2-Methoxyphenyl)-2-(dicyclohexylphosphino)pyrrole

Catalog Number ACM672937632-2
CAS 672937-63-2
Structure {[CurrentData.Name]}
Synonyms 2-(Dicyclohexylphosphino)-1-(2-Methoxyphenyl)-1H-Pyrrole
IUPAC Name dicyclohexyl-[1-(2-methoxyphenyl)pyrrol-2-yl]phosphane
Molecular Weight 369.48
Molecular Formula C23H32NOP
InChI JUZAKZRALSJLOV-UHFFFAOYSA-N
InChI Key InChI=1S/C23H32NOP/c1-25-22-16-9-8-15-21(22)24-18-10-17-23(24)26(19-11-4-2-5-12-19)20-13-6-3-7-14-20/h8-10,15-20H,2-7,11-14H2,1H3
Boiling Point 517.7±30.0 °C(Predicted)
Melting Point 96-97 °C
Purity 98%
Appearance Solid
Exact Mass 369.22200
Isomeric SMILES COC1=CC=CC=C1N2C=CC=C2P(C3CCCCC3)C4CCCCC4
pKa -6.63±0.70(Predicted)
Type cataCXium
Q&A

What is the CAS number for the compound?

The CAS number for the compound is 672937-63-2.

What is the exact mass of the compound?

The exact mass of the compound is 369.22215164.

What is the Canonical SMILES representation of the compound?

The Canonical SMILES representation of the compound is COC1=CC=CC=C1N2C=CC=C2P(C3CCCCC3)C4CCCCC4.

How many heavy atoms are present in the compound?

There are 26 heavy atoms present in the compound.

What is the Molecular Weight of the compound?

The Molecular Weight of the compound is 369.5g/mol.

What is the IUPAC Name of the compound?

The IUPAC Name of the compound is dicyclohexyl-[1-(2-methoxyphenyl)pyrrol-2-yl]phosphane.

How many covalently-bonded units are present in the compound?

There is 1 covalently-bonded unit present in the compound.

How many rotatable bonds are present in the compound?

There are 5 rotatable bonds present in the compound.

How many hydrogen bond acceptors are present in the compound?

There is 1 hydrogen bond acceptor present in the compound.

What is the InChIKey of the compound?

The InChIKey of the compound is JUZAKZRALSJLOV-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.