1,2-Diphenylethylenediamine

Catalog Number	ACM16635953
CAS	16635-95-3
Structure
Synonyms	1,2-Diphenylethane-1,2-Diamine; (±)-1,2-Diphenylethylenediamine
IUPAC Name	1,2-diphenylethane-1,2-diamine
Molecular Weight	212.29
Molecular Formula	C14H16N2
InChI	PONXTPCRRASWKW-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2
Boiling Point	353.9°C at 760 mmHg
Melting Point	123-125 °C-lit.
Purity	98%+
Appearance	Solid
Isomeric SMILES	C1=CC=C(C=C1)C(C(C2=CC=CC=C2)N)N

Q&A

What is the chemical formula (MF) of 1,2-Diphenylethylenediamine?

The chemical formula (MF) of 1,2-Diphenylethylenediamine is C14H16N2.

What is the boiling point of 1,2-Diphenylethylenediamine?

The boiling point of 1,2-Diphenylethylenediamine is 305-307 °C at 744 mm Hg.

What is the storage temperature recommended for 1,2-Diphenylethylenediamine?

The recommended storage temperature for 1,2-Diphenylethylenediamine is 2-8°C.

In what form does 1,2-Diphenylethylenediamine exist, from powder to what?

1,2-Diphenylethylenediamine exists in the form of powder to crystal.

Can 1,2-Diphenylethylenediamine react with catecholamines to give a compound that fluoresces intensely?

Yes, 1,2-Diphenylethylenediamine can react with catecholamines to give a compound that fluoresces intensely.

What type of medium is required for 1,2-Diphenylethylenediamine to react with catechol compounds in the presence of hexacyanoferrate(III)?

The reaction of 1,2-Diphenylethylenediamine with catechol compounds requires a neutral medium.

What amino acid accelerates the reaction of 1,2-Diphenylethylenediamine with catecholamines?

Glycine is an amino acid that accelerates the reaction of 1,2-Diphenylethylenediamine with catecholamines.

How sensitive is the method described by Nohta et al. for determining catecholamines with 1,2-Diphenylethylenediamine?

The method described by Nohta et al. is very sensitive and can determine catecholamines at concentrations as low as 15-20 pmol ml-1.

What are the hazard codes associated with 1,2-Diphenylethylenediamine?

The hazard codes associated with 1,2-Diphenylethylenediamine are Xn and N.

What product categories does 1,2-Diphenylethylenediamine belong to?

1,2-Diphenylethylenediamine belongs to the DPEN Series and Achiral Nitrogen product categories.