ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,2-Di(naphthalen-1-yl)ethane-1,2-diamine

Catalog Number ACM618092221-1
CAS 618092-22-1
IUPAC Name 1,2-dinaphthalen-1-ylethane-1,2-diamine
Molecular Weight 312.41
Molecular Formula C22H20N2
InChI VVJVMUUCGDSHBT-UHFFFAOYSA-N
InChI Key InChI=1S/C22H20N2/c23-21(19-13-5-9-15-7-1-3-11-17(15)19)22(24)20-14-6-10-16-8-2-4-12-18(16)20/h1-14,21-22H,23-24H2
Purity 98%
Appearance Solid
Isomeric SMILES C1=CC=C2C(=C1)C=CC=C2C(C(C3=CC=CC4=CC=CC=C43)N)N
Q&A

What is the CAS number of 1,2-Di(naphthalen-1-yl)ethane-1,2-diamine?

CAS Number: 618092-22-1

What is the molecular weight of 1,2-Di(naphthalen-1-yl)ethane-1,2-diamine?

Molecular Weight: 312.41

What is the product name associated with 1,2-Di(naphthalen-1-yl)ethane-1,2-diamine?

Product Name: AURORA KA-7324

What are the synonyms of 1,2-Di(naphthalen-1-yl)ethane-1,2-diamine?

Synonyms: 1,2-dinaphthalen-1-ylethane-1,2-diamine; 1,2-DI(1-NAPHTHYL)-1,2-ETHANEDIAMINE; 1,2-Ethanediamine, 1,2-di-1-naphthalenyl-

What is the molecular formula of 1,2-Di(naphthalen-1-yl)ethane-1,2-diamine?

Molecular Formula: C22H20N2

What is the predicted boiling point of 1,2-Di(naphthalen-1-yl)ethane-1,2-diamine?

Boiling Point: 529.8±45.0 °C (Predicted)

What is the predicted pka value of 1,2-Di(naphthalen-1-yl)ethane-1,2-diamine?

pka: 8.04±0.30 (Predicted)

What is the predicted density of 1,2-Di(naphthalen-1-yl)ethane-1,2-diamine?

Density: 1.201±0.06 g/cm3 (Predicted)

What are the predicted physical properties of 1,2-Di(naphthalen-1-yl)ethane-1,2-diamine?

The predicted boiling point is 529.8±45.0 °C, pka value is 8.04±0.30, and density is 1.201±0.06 g/cm3.

Please kindly note that our products and services are for research use only.