What is the molecular formula of 1,2-Bis(diphenylphosphinomethyl)benzene?
The molecular formula of 1,2-Bis(diphenylphosphinomethyl)benzene is C32H28P2.
What is the CAS number for 1,2-Bis(diphenylphosphinomethyl)benzene?
The CAS number for 1,2-Bis(diphenylphosphinomethyl)benzene is 62144-65-4.
What is the Canonical SMILES representation of 1,2-Bis(diphenylphosphinomethyl)benzene?
The Canonical SMILES representation of 1,2-Bis(diphenylphosphinomethyl)benzene is C1=CC=C(C=C1)P(CC2=CC=CC=C2CP(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5.
How many heavy atoms are present in the molecular structure of 1,2-Bis(diphenylphosphinomethyl)benzene?
There are 34 heavy atoms present in the molecular structure of 1,2-Bis(diphenylphosphinomethyl)benzene.
Does 1,2-Bis(diphenylphosphinomethyl)benzene have any hydrogen bond acceptor or donor counts?
No, 1,2-Bis(diphenylphosphinomethyl)benzene does not have any hydrogen bond acceptor or donor counts.
What is the XLogP3 value for 1,2-Bis(diphenylphosphinomethyl)benzene?
The XLogP3 value for 1,2-Bis(diphenylphosphinomethyl)benzene is 7.2.
What is the molecular weight of 1,2-Bis(diphenylphosphinomethyl)benzene?
The molecular weight of 1,2-Bis(diphenylphosphinomethyl)benzene is 474.5 g/mol.
What is the IUPAC name of 1,2-Bis(diphenylphosphinomethyl)benzene?
The IUPAC name of 1,2-Bis(diphenylphosphinomethyl)benzene is [2-(diphenylphosphanylmethyl)phenyl]methyl-diphenylphosphane.