What is the molecular formula of 1,2-Bis(dipentafluorophenylphosphino)ethane?
The molecular formula is C26H4F20P2.
What is the IUPAC name of 1,2-Bis(dipentafluorophenylphosphino)ethane?
The IUPAC name is 2-bis(2,3,4,5,6-pentafluorophenyl)phosphanylethyl-bis(2,3,4,5,6-pentafluorophenyl)phosphane.
What is the CAS number of 1,2-Bis(dipentafluorophenylphosphino)ethane?
The CAS number is 76858-94-1.
What is the molecular weight of 1,2-Bis(dipentafluorophenylphosphino)ethane?
The molecular weight is 758.2 g/mol.
How many hydrogen bond acceptors does 1,2-Bis(dipentafluorophenylphosphino)ethane have?
It has 20 hydrogen bond acceptors.
How many rotatable bonds does 1,2-Bis(dipentafluorophenylphosphino)ethane have?
It has 7 rotatable bonds.
What is the Canonical SMILES of 1,2-Bis(dipentafluorophenylphosphino)ethane?
The Canonical SMILES is C(CP(C1=C(C(=C(C(=C1F)F)F)F)F)C2=C(C(=C(C(=C2F)F)F)F)F)P(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.
What is the XLogP3 value of 1,2-Bis(dipentafluorophenylphosphino)ethane?
The XLogP3 value is 7.9.
How many heavy atoms are present in 1,2-Bis(dipentafluorophenylphosphino)ethane?
There are 48 heavy atoms.
What is the InChIKey of 1,2-Bis(dipentafluorophenylphosphino)ethane?
The InChIKey is IGLFIYOFKVGEBP-UHFFFAOYSA-N.