What is the IUPAC name of the compound 1,2-Bis(dicyclohexylphosphino)ethane bis(tetrafluoroborate)?
The IUPAC name of the compound is dicyclohexyl(2-dicyclohexylphosphanylethyl)phosphane; ditetrafluoroborate.
What is the molecular formula of 1,2-Bis(dicyclohexylphosphino)ethane bis(tetrafluoroborate)?
The molecular formula is C26H48B2F8P2-2.
What is the molecular weight of 1,2-Bis(dicyclohexylphosphino)ethane bis(tetrafluoroborate)?
The molecular weight is 596.2g/mol.
How many covalently-bonded units are present in the compound?
There are 3 covalently-bonded units.
What is the exact mass of 1,2-Bis(dicyclohexylphosphino)ethane bis(tetrafluoroborate)?
The exact mass is 596.3289612.
How many hydrogen bond acceptors are there in the compound?
There are 10 hydrogen bond acceptors.
What is the Canonical SMILES of the compound?
[B-](F)(F)(F)F.[B-](F)(F)(F)F.C1CCC(CC1)P(CCP(C2CCCCC2)C3CCCCC3)C4CCCCC4
What is the InChIKey of 1,2-Bis(dicyclohexylphosphino)ethane bis(tetrafluoroborate)?
The InChIKey is JOBMUOAMAMSRBN-UHFFFAOYSA-N.
What are some depositor-supplied synonyms for the compound?
Some synonyms include dicyclohexyl(2-dicyclohexylphosphanylethyl)phosphane; ditetrafluoroborate and 1,2-Bis(dicyclohexylphosphonium)ethane bis(tetrafluoroborate).
What is the European Community (EC) Number of the compound?
The European Community (EC) Number is 943-410-3.
