1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane

Catalog Number	ACM19896185-1
CAS	19896-18-5
Structure
Synonyms	1,2-Bis(4,4-dimethyl-2-oxazolin-2-yl)ethane; 2,2'-(1,2-Ethanediyl)bis[4,5-dihydro-4,4-dimethyl]oxazole
IUPAC Name	2-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)ethyl]-4,4-dimethyl-5H-1,3-oxazole
Molecular Weight	224.30
Molecular Formula	C12H20N2O2
InChI	UFUAASKHUNQXBP-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H20N2O2/c1-11(2)7-15-9(13-11)5-6-10-14-12(3,4)8-16-10/h5-8H2,1-4H3
Melting Point	55-58 °C-lit.
Purity	98%
Appearance	Solid
Isomeric SMILES	CC1(COC(=N1)CCC2=NC(CO2)(C)C)C

Q&A

What is the molecular weight of 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane?

The molecular weight is 224.3.

What are some product categories that 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane falls under?

It falls under Josiphos Ligands, Chemical Synthesis, Catalysis and Inorganic Chemistry, Other Ligands, Privileged Ligands and Complexes, and Solvias Ligands and Complexes.

What are some synonyms for 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane?

Some synonyms are LABOTEST-BB LT00452960, 1 2-BIS(4 4-DIMETHYL-2-OXAZOLIN-2-YL)ETHANE, and 1,2-bis(4-dimethyl-2-oxazolin-2-yl)ethane.

What is the melting point of 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane?

The melting point is 55-58 °C (lit.).

What is the predicted density of 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane?

The predicted density is 1.13±0.1 g/cm3.

What is the predicted boiling point of 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane?

The predicted boiling point is 287.5±23.0 °C.

What is the pka value of 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane?

The pka is 5.85±0.70.

What are the hazard codes associated with 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane?

The hazard code is Xi.

What are the safety statements related to 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane?

The safety statements are 26-37/39.

What is the risk statement for 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)ethane?

The risk statement is 36/37/38.