1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)benzene

Catalog Number	ACM131380842
CAS	131380-84-2
Synonyms	2-[2-(4,4-Dimethyl-5H-1,3-Oxazol-2-Yl)Phenyl]-4,4-Dimethyl-5H-1,3-Oxazole
IUPAC Name	2-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-4,4-dimethyl-5H-1,3-oxazole
Molecular Weight	272.34
Molecular Formula	C16H20N2O2
InChI	OKIMHKPCSVCCRG-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H20N2O2/c1-15(2)9-19-13(17-15)11-7-5-6-8-12(11)14-18-16(3,4)10-20-14/h5-8H,9-10H2,1-4H3
Purity	98%
Isomeric SMILES	CC1(COC(=N1)C2=CC=CC=C2C3=NC(CO3)(C)C)C

Q&A

What is the CAS number for 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)benzene?

The CAS number is 131380-84-2.

What is the molecular weight of 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)benzene?

The molecular weight is 272.34.

What is the product name of this compound?

The product name is Oxazole, 2,2'-(1,2-phenylene)bis[4,5-dihydro-4,4-dimethyl-.

What are the synonyms for 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)benzene?

The synonyms are Oxazole, 2,2'-(1,2-phenylene)bis[4,5-dihydro-4,4-dimethyl- and 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)benzene.

What is the molecular formula of this compound?

The molecular formula is C16H20N2O2.

What is the predicted boiling point of 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)benzene?

The predicted boiling point is 397.0±25.0 °C.

What is the predicted pka value of this compound?

The predicted pka value is 4.81±0.70.

What is the predicted density of 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)benzene?

The predicted density is 1.16±0.1 g/cm3.

How many nitrogen atoms are present in the molecular formula of this compound?

There are 2 nitrogen atoms present.

What is the chemical structure of 1,2-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)benzene?

The chemical structure is a benzene ring with two side chains of 4,4-dimethyl-4,5-dihydrooxazol-2-yl.