ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

(+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene

Catalog Number ACM136779287-1
CAS 136779-28-7
Structure (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene
Synonyms (2S,2'S,5S,5'S)-2,2',5,5'-Tetraethyl-1,1'-(o-phenylene)diphospholane; (S,S)-Ethyl-DUPHOS
IUPAC Name (2S,5S)-1-[2-[(2S,5S)-2,5-diethylphospholan-1-yl]phenyl]-2,5-diethylphospholane
Molecular Weight 362.48
Molecular Formula C22H36P2
InChI GVVCHDNSTMEUCS-MUGJNUQGSA-N
InChI Key InChI=1S/C22H36P2/c1-5-17-13-14-18(6-2)23(17)21-11-9-10-12-22(21)24-19(7-3)15-16-20(24)8-4/h9-12,17-20H,5-8,13-16H2,1-4H3/t17-,18-,19-,20-/m0/s1
Boiling Point 468.5±15.0 °C(Predicted)
Flash Point >230 °F
Density 1.01 g/mL at 25 °C
Isomeric SMILES CC[C@H]1CC[C@@H](P1C2=CC=CC=C2P3[C@H](CC[C@@H]3CC)CC)CC
Q&A

What is the IUPAC Name of the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene?

The IUPAC Name is (2S,5S)-1-[2-[(2S,5S)-2,5-diethylphospholan-1-yl]phenyl]-2,5-diethylphospholane.

What is the CAS number of the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene?

The CAS number is 136779-28-7.

What is the molecular formula of the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene?

The molecular formula is C22H36P2.

What is the molecular weight of the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene?

The molecular weight is 362.5g/mol.

How many covalently-bonded units are present in the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene?

There is 1 covalently-bonded unit.

How many formal charges are present in the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene?

There are 0 formal charges.

What is the XLogP3 value of the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene?

The XLogP3 value is 5.9.

What is the InChIKey of the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene?

The InChIKey is GVVCHDNSTMEUCS-MUGJNUQGSA-N.

Provide one of the Depositor-Supplied Synonyms for the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene.

One of the synonyms is (+)-Duphos.

What is the exact mass of the compound (+)-1,2-Bis[(2S,5S)-2,5-diethylphospholano]benzene?

The exact mass is 362.22922514 daltons.

Please kindly note that our products and services are for research use only.