1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane

Catalog Number	ACM129648073-1
CAS	129648-07-3
Structure
Synonyms	(R,R)-Me-BPE;1,2-Bis[(2R,5R)-2,5-dimethylphospholan-1-yl]ethane
IUPAC Name	(2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]ethyl]-2,5-dimethylphospholane
Molecular Weight	258.32
Molecular Formula	C14H28P2
InChI	IRCDUOCGSIGEAI-AAVRWANBSA-N
InChI Key	InChI=1S/C14H28P2/c1-11-5-6-12(2)15(11)9-10-16-13(3)7-8-14(16)4/h11-14H,5-10H2,1-4H3/t11-,12-,13-,14-/m1/s1
Boiling Point	64-67 °C at 0.06 mmHg
Purity	95%+
Density	0.940 g/mL at 25 °C
Appearance	Liquid
Isomeric SMILES	C[C@@H]1CC[C@H](P1CCP2[C@@H](CC[C@H]2C)C)C

Q&A

What is the IUPAC name of 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

The IUPAC name is (2R,5R)-1-[2-[(2R,5R)-2,5-dimethylphospholan-1-yl]ethyl]-2,5-dimethylphospholane.

What is the molecular formula of 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

The molecular formula is C14H28P2.

What is the molecular weight of 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

The molecular weight is 258.32 g/mol.

What is the CAS number of 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

The CAS number is 129648-07-3.

What is the Canonical SMILES representation of 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

The Canonical SMILES is CC1CCC(P1CCP2C(CCC2C)C)C.

How many defined atom stereocenters are present in 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

There are 4 defined atom stereocenters.

What is the XLogP3 value of 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

The XLogP3 value is 2.4.

What are some of the alternate names or synonyms for 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

Some synonyms include Bpe ligands (R,R)-me-bpe, Me-bpe, (R,R)-, and (S,S)-Me-en-duphos.

What is the Monoisotopic Mass of 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

The Monoisotopic Mass is 258.16662489.

What is the UNII number of 1,2-Bis((2R,5R)-2,5-dimethylphospholano)ethane compound?

The UNII number is 1LS1AFH1F1.