ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride

Catalog Number ACM1583244078
CAS 1583244-07-8
Synonyms 1-(1-Adamantyl)-3-(2,4,6-trimethylphenyl)imidazol-1-ium chloride
IUPAC Name 1-(1-adamantyl)-3-(2,4,6-trimethylphenyl)imidazol-1-ium;chloride
Molecular Weight 356.93
Molecular Formula C22H29ClN2
InChI JBJSHXRDCKLAKW-UHFFFAOYSA-M
InChI Key InChI=1S/C22H29N2.ClH/c1-15-6-16(2)21(17(3)7-15)23-4-5-24(14-23)22-11-18-8-19(12-22)10-20(9-18)13-22;/h4-7,14,18-20H,8-13H2,1-3H3;1H/q+1;/p-1
Purity 98%
Appearance Solid
Isomeric SMILES CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)C34CC5CC(C3)CC(C5)C4)C.[Cl-]
Q&A

What is the molecular weight of 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride?

The molecular weight is 356.93206.

What are the product categories that 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride belongs to?

It belongs to Achiral Nitrogen and NHC product categories.

What is the product name of this compound?

The product name is 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride.

What are the synonyms for 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride?

Some synonyms include 1-(2,4,6-TRIMETHYLPHENYL)-3-(ADAMANTYL)IMIDAZOLIUM CHLORIDE, MIN.97% and 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride, min. 97%.

What is the chemical formula (MF) of 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride?

The chemical formula is C22H29ClN2.

What form does 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride come in?

It comes in a powder form.

How would you describe the stability of 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride?

It is considered hygroscopic, meaning it absorbs moisture from the air.

What color is 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride?

It is white to off-white in color.

How is the compound represented chemically?

It is represented as 1-(2,4,6-Trimethylphenyl)-3-(adamantyl)imidazolium chloride.

What is the CAS number for this compound?

The CAS number is 1583244-07-8.

Please kindly note that our products and services are for research use only.