What is the CAS number of the compound 1-(2,4,6-Trimethylphenyl)-2-(dicyclohexylphosphino)imidazole?
The CAS number is 794527-14-3.
What is the Canonical SMILES of 1-(2,4,6-Trimethylphenyl)-2-(dicyclohexylphosphino)imidazole?
The Canonical SMILES is CC1=CC(=C(C(=C1)C)N2C=CN=C2P(C3CCCCC3)C4CCCCC4)C.
How many Heavy Atoms are present in the compound?
There are 27 Heavy Atoms.
What is the XLogP3 value of 1-(2,4,6-Trimethylphenyl)-2-(dicyclohexylphosphino)imidazole?
The XLogP3 value is 6.3.
What is the IUPAC Name of the compound?
The IUPAC Name is dicyclohexyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane.
What is the Molecular Formula of 1-(2,4,6-Trimethylphenyl)-2-(dicyclohexylphosphino)imidazole?
The Molecular Formula is C24H35N2P.
What is the Monoisotopic Mass of the compound?
The Monoisotopic Mass is 382.25378612.
What is the InChIKey of 1-(2,4,6-Trimethylphenyl)-2-(dicyclohexylphosphino)imidazole?
The InChIKey is ZRVANNJGPCSNAH-UHFFFAOYSA-N.
What is the Computed Properties Rotatable Bond Count of the compound?
The Computed Properties Rotatable Bond Count is 4.
What are some Depositor-Supplied Synonyms of 1-(2,4,6-Trimethylphenyl)-2-(dicyclohexylphosphino)imidazole?
Some Depositor-Supplied Synonyms include 2-(Dicyclohexylphosphino)-1-mesityl-1H-imidazole and DTXSID00696508.