1,2,3-Propanetricarboxylic acid, 2-hydroxy-, copper salt

Catalog Number	ACM10402150-1
CAS	10402-15-0
Structure
Synonyms	Copper;2-hydroxypropane-1,2,3-tricarboxylic acid
Molecular Weight	255.67
Molecular Formula	C6H8CuO7
Canonical SMILES	C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Cu+2]
InChI	InChI=1S/C6H8O7.Cu/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+2
InChI Key	QDUNDCWSEGVAAB-UHFFFAOYSA-N
Melting Point	100 °C
Purity	99%
Appearance	Solid
Exact Mass	254.9566
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	4
Monoisotopic Mass	254.9566
Rotatable Bond Count	5
Topological Polar Surface Area	132 Ų

Q&A

What is the chemical formula of Cupric citrate?

The chemical formula of Cupric citrate is C6H8CuO7.

What is the molecular weight of Cupric citrate?

The molecular weight of Cupric citrate is 255.67.

How can Cupric citrate be prepared?

Cupric citrate can be prepared by reacting hot citric acid with copper sulfate solutions.

In what form is Cupric citrate commonly found?

Cupric citrate is commonly found in the form of green or bluish green crystals or crystalline powder.

What is the solubility of Cupric citrate in water?

Cupric citrate is slightly soluble in water but soluble in ammonia and dilute acids.

What is the melting point of Cupric citrate?

The melting point of Cupric citrate is approximately 100°C.

What are some of the uses of Cupric citrate?

Cupric citrate is used in the study of the effects of copper on the activity and kinetics of acid phosphatase, and for the preparation of antiwear and antioxidant lubricating oil.

What are some synonyms for Cupric citrate?

Some synonyms for Cupric citrate include COPPER (II) CITRATE, CUPRIC CITRATE TS, COPPER CITRATE HEMITRIHYDRATE, and Citric acid copper.

What is the color of Cupric citrate crystals?

The color of Cupric citrate crystals is blue-green.

What is the EPA Substance Registry System number for Cupric citrate?

The EPA Substance Registry System number for Cupric citrate is 10402-15-0.