ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene

Catalog Number ACM312959243-1
CAS 312959-24-3
Structure 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene
Synonyms CTC-Q-PHOS
Molecular Weight 710.71
Molecular Formula C48H47FeP
Melting Point 211-219 °C
Purity 97%
Appearance Solid
Q&A

What is the exact mass of 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene?

The exact mass is 710.276474 g/mol.

What is the IUPAC Name of 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene?

The IUPAC Name is ditert-butyl(cyclopenta-1,3-dien-1-yl)phosphane;iron(2+);(2,3,4,5-tetraphenylcyclopenta-1,4-dien-1-yl)benzene.

What is the Canonical SMILES of 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene?

CC(C)(C)P(C1=CC=C[CH-]1)C(C)(C)C.C1=CC=C(C=C1)[C-]2C(=C(C(=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6.[Fe+2]

How many heavy atoms does 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene contain?

It contains 50 heavy atoms.

What is the molecular formula of 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene?

The molecular formula is C48H47FeP.

How many rotatable bonds are present in 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene?

There are 8 rotatable bonds.

What is the mono-isotopic mass of 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene?

The mono-isotopic mass is 710.276474 g/mol.

How many covalently-bonded units are there in 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene?

There are 3 covalently-bonded units.

Does 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene have any hydrogen bond acceptors?

Yes, it has 2 hydrogen bond acceptors.

What is the InChIKey of 1,2,3,4,5-Pentaphenyl-1'-(di-t-butylphosphino)ferrocene?

The InChIKey is BOBUBHOXRCYKLI-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.