ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,2,3,4,5-Pentamethylcyclopentadiene

Catalog Number ACM4045447-2
CAS 4045-44-7
Structure {[CurrentData.Name]}
Synonyms Pentamethylcyclopentadiene; 1,2,3,4,5-pentamethylcyclopenta-1,3-diene
IUPAC Name 1,2,3,4,5-pentamethylcyclopenta-1,3-diene
Molecular Weight 136.24
Molecular Formula C10H16
InChI WQIQNKQYEUMPBM-UHFFFAOYSA-N
InChI Key InChI=1S/C10H16/c1-6-7(2)9(4)10(5)8(6)3/h6H,1-5H3
Boiling Point 60 °C at 14 mmHg
Flash Point 44 °C
Purity 98%
Density 0.87 g/cm3
Appearance Colorless liquid
Isomeric SMILES CC1C(=C(C(=C1C)C)C)C
Q&A

What is the molecular formula of 1,2,3,4,5-Pentamethylcyclopentadiene?

The molecular formula of 1,2,3,4,5-Pentamethylcyclopentadiene is C10H16.

What is the molecular weight of 1,2,3,4,5-Pentamethylcyclopentadiene?

The molecular weight of 1,2,3,4,5-Pentamethylcyclopentadiene is 136.23 g/mol.

What is the IUPAC name of 1,2,3,4,5-Pentamethylcyclopentadiene?

The IUPAC name of 1,2,3,4,5-Pentamethylcyclopentadiene is 1,2,3,4,5-pentamethylcyclopenta-1,3-diene.

What is the InChI of 1,2,3,4,5-Pentamethylcyclopentadiene?

The InChI of 1,2,3,4,5-Pentamethylcyclopentadiene is InChI=1S/C10H16/c1-6-7(2)9(4)10(5)8(6)3/h6H,1-5H3.

What is the InChIKey of 1,2,3,4,5-Pentamethylcyclopentadiene?

The InChIKey of 1,2,3,4,5-Pentamethylcyclopentadiene is WQIQNKQYEUMPBM-UHFFFAOYSA-N.

What is the canonical SMILES of 1,2,3,4,5-Pentamethylcyclopentadiene?

The canonical SMILES of 1,2,3,4,5-Pentamethylcyclopentadiene is CC1C(=C(C(=C1C)C)C)C.

What is the CAS number of 1,2,3,4,5-Pentamethylcyclopentadiene?

The CAS number of 1,2,3,4,5-Pentamethylcyclopentadiene is 4045-44-7.

What is the XLogP3-AA value of 1,2,3,4,5-Pentamethylcyclopentadiene?

The XLogP3-AA value of 1,2,3,4,5-Pentamethylcyclopentadiene is 1.9.

How many hydrogen bond donor counts does 1,2,3,4,5-Pentamethylcyclopentadiene have?

1,2,3,4,5-Pentamethylcyclopentadiene has 0 hydrogen bond donor count.

How many heavy atoms does 1,2,3,4,5-Pentamethylcyclopentadiene have?

1,2,3,4,5-Pentamethylcyclopentadiene has 10 heavy atoms.

Please kindly note that our products and services are for research use only.