1-([2,2'-Bipyridin]-6-yl)ethanone

Catalog Number	ACM126770421
CAS	126770-42-1
Synonyms	6-Acetyl-2,2'-Bipyridine; Ethanone,1-[2,2'-Bipyridin]-6-Yl-
IUPAC Name	1-(6-pyridin-2-ylpyridin-2-yl)ethanone
Molecular Weight	198.22
Molecular Formula	C12H10N2O
InChI	ZHIFOTWXGZPWDH-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H10N2O/c1-9(15)10-6-4-7-12(14-10)11-5-2-3-8-13-11/h2-8H,1H3
Purity	97%
Isomeric SMILES	CC(=O)C1=CC=CC(=N1)C2=CC=CC=N2

Q&A

What is the CAS number of 1-([2,2'-Bipyridin]-6-yl)ethanone?

The CAS number of 1-([2,2'-Bipyridin]-6-yl)ethanone is 126770-42-1.

What is the molecular weight of 1-([2,2'-Bipyridin]-6-yl)ethanone?

The molecular weight of 1-([2,2'-Bipyridin]-6-yl)ethanone is 198.22.

What is another name for 1-([2,2'-Bipyridin]-6-yl)ethanone?

Another name for 1-([2,2'-Bipyridin]-6-yl)ethanone is 6-acetyl-2,2'-bipyridine.

How is 1-([2,2'-Bipyridin]-6-yl)ethanone written in chemical formula notation?

The compound is written as MF:C12H10N2O.

What is the chemical name of 1-([2,2'-Bipyridin]-6-yl)ethanone?

The chemical name of 1-([2,2'-Bipyridin]-6-yl)ethanone is Ethanone, 1-[2,2'-bipyridin]-6-yl-.

Is 1-([2,2'-Bipyridin]-6-yl)ethanone a common chemical compound?

The compound is not a common chemical compound.

What are the elements present in 1-([2,2'-Bipyridin]-6-yl)ethanone?

The elements present in 1-([2,2'-Bipyridin]-6-yl)ethanone are carbon, hydrogen, and nitrogen.

What functional groups are present in 1-([2,2'-Bipyridin]-6-yl)ethanone?

The functional groups present in 1-([2,2'-Bipyridin]-6-yl)ethanone are ketone and bipyridine.

What is the structure of 1-([2,2'-Bipyridin]-6-yl)ethanone?

The structure of 1-([2,2'-Bipyridin]-6-yl)ethanone is derived from a bipyridine molecule with a ketone group attached at the 6th position.

What are some potential uses of 1-([2,2'-Bipyridin]-6-yl)ethanone?

The compound may have applications in chemical research, organic synthesis, and pharmaceuticals due to its unique structure and properties.