ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1-((11bS)-8,9,10,11,12,13,14,15-Octahydrodinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-yl)pyrrolidine

Catalog Number ACM625090995
CAS 625090-99-5
Structure {[CurrentData.Name]}
Synonyms Pyrrolidine, 1-[(11bS)-8,9,10,11,12,13,14,15-octahydrodinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-yl]- (9CI)
IUPAC Name 1-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),9,16,18(23)-hexaen-13-yl)pyrrolidine
Molecular Weight 393.47
Molecular Formula C24H28NO2P
InChI IPPGHIOZFPVFGC-UHFFFAOYSA-N
InChI Key InChI=1S/C24H28NO2P/c1-3-9-19-17(7-1)11-13-21-23(19)24-20-10-4-2-8-18(20)12-14-22(24)27-28(26-21)25-15-5-6-16-25/h11-14H,1-10,15-16H2
Boiling Point 561.9±60.0 °C(Predicted)
Melting Point 67 °C
Purity 97%
Isomeric SMILES C1CCC2=C(C1)C=CC3=C2C4=C(C=CC5=C4CCCC5)OP(O3)N6CCCC6
pKa 2?+-.0.20(Predicted)
Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C24H28NO2P.

What is the molecular weight of the compound?

The molecular weight of the compound is 393.5g/mol.

What is the Canonical SMILES notation of the compound?

The Canonical SMILES notation of the compound is C1CCC2=C(C1)C=CC3=C2C4=C(C=CC5=C4CCCC5)OP(O3)N6CCCC6.

How many heavy atoms are present in the compound?

There are 28 heavy atoms present in the compound.

What is the computed XLogP3 value of the compound?

The computed XLogP3 value of the compound is 6.8.

What is the name of the compound according to IUPAC nomenclature?

The IUPAC name of the compound is 1-(12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),9,16,18(23)-hexaen-13-yl)pyrrolidine.

What is the exact mass of the compound?

The exact mass of the compound is 393.18576613.

How many covalently-bonded units are present in the compound?

There is 1 covalently-bonded unit present in the compound.

How many hydrogen bond acceptors are there in the compound?

There are 3 hydrogen bond acceptors in the compound.

What is the InChIKey of the compound?

The InChIKey of the compound is IPPGHIOZFPVFGC-UHFFFAOYSA-N.

Please kindly note that our products and services are for research use only.