1,10-Phenanthroline monohydrochloride monohydrate

Catalog Number	ACM18851337-1
CAS	18851-33-7
Structure
Synonyms	1,10-Phenanthroline hydrochloride hydrate
IUPAC Name	1,10-phenanthroline;hydrate;hydrochloride
Molecular Weight	234.68
Molecular Formula	C12H11ClN2O
Canonical SMILES	C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.O.Cl
InChI	NDLHUHRGAIHALB-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H8N2.ClH.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;/h1-8H;1H;1H2
Boiling Point	365.1 °C at 760 mmHg
Melting Point	224-225 °C-lit.
Purity	99%
Appearance	White fine crystalline powder
EC Number	223-325-1
Exact Mass	234.0559907
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	234.0559907
Rotatable Bond Count	0
Topological Polar Surface Area	26.8 Ų

Q&A

What is the chemical formula of 1,10-Phenanthroline monohydrochloride monohydrate?

The chemical formula is C12H8N2.ClH.

What is the molecular weight of 1,10-Phenanthroline monohydrochloride monohydrate?

The molecular weight is 216.67 g/mol.

What is the product category to which 1,10-Phenanthroline monohydrochloride monohydrate belongs?

It belongs to the product categories of Heterocyclic Compounds, Analytical Chemistry, Aromatic Hydrocarbons (substituted) & Derivatives, and Chelating Reagents.

What is the melting point of 1,10-Phenanthroline monohydrochloride monohydrate?

The melting point is 224-225 °C.

What is the solubility of 1,10-Phenanthroline monohydrochloride monohydrate in water?

It is soluble in water at 0.1 g/mL.

What are some synonyms for 1,10-Phenanthroline monohydrochloride monohydrate?

Some synonyms include o-Phenanthroline monohydrochloride monohydrate, 1,10-Phenanthroline HCL, and 1,10-Phenanthroline monohydrochloride monohydrate.

What are the hazard codes associated with 1,10-Phenanthroline monohydrochloride monohydrate?

The hazard codes are T and N.

How is 1,10-Phenanthroline monohydrochloride monohydrate commonly used?

It is commonly used as a useful research chemical.

What safety statements are associated with 1,10-Phenanthroline monohydrochloride monohydrate?

Safety Statements 45-60-61 are associated with it.

What is the color of 1,10-Phenanthroline monohydrochloride monohydrate?

The color is described as white to light yellow or slightly purple powder.