1,10-Phenanthroline hydrochloride

Catalog Number	ACM3829865-1
CAS	3829-86-5
Structure
Synonyms	o-Phenanthroline hydrochloride
IUPAC Name	1,10-phenanthroline;hydrochloride
Molecular Weight	216.67
Molecular Formula	C12H9ClN2
InChI	QPXDKQBBJCTNOY-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H8N2.ClH/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-8H;1H
Boiling Point	365.1 °C at 760 mmHg
Melting Point	224-225 °C-lit.
Purity	99%
Appearance	Off-white solid
Isomeric SMILES	C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.Cl

Q&A

What is the CAS number of 1,10-Phenanthroline hydrochloride?

The CAS number of 1,10-Phenanthroline hydrochloride is 3829-86-5.

What is the molecular weight of 1,10-Phenanthroline hydrochloride?

The molecular weight of 1,10-Phenanthroline hydrochloride is 216.67.

In what product categories does 1,10-Phenanthroline hydrochloride belong?

1,10-Phenanthroline hydrochloride belongs to product categories such as Heterocyclic Compounds, Analytical Chemistry, Aromatic Hydrocarbons (substituted) & Derivatives, and Chelating Reagents.

What is another name for 1,10-Phenanthroline hydrochloride?

Another name for 1,10-Phenanthroline hydrochloride is o-Phenanthroline monohydrochloride monohydrate.

What is the chemical formula of 1,10-Phenanthroline hydrochloride?

The chemical formula of 1,10-Phenanthroline hydrochloride is C12H8N2.ClH.

What is the water solubility of 1,10-Phenanthroline hydrochloride?

1,10-Phenanthroline hydrochloride is soluble in water at a rate of 0.1 g/mL and appears clear.

What is the melting point of 1,10-Phenanthroline hydrochloride?

The melting point of 1,10-Phenanthroline hydrochloride is 224-225 °C.

What is the color of 1,10-Phenanthroline hydrochloride?

The color of 1,10-Phenanthroline hydrochloride is white to light yellow or slightly purple.

What are the hazard codes associated with 1,10-Phenanthroline hydrochloride?

The hazard codes associated with 1,10-Phenanthroline hydrochloride are T and N.

How is 1,10-Phenanthroline hydrochloride commonly used?

1,10-Phenanthroline Hydrochloride is commonly used as a useful research chemical.