1,10-Phenanthroline hydrate

Catalog Number	ACM5144898-1
CAS	5144-89-8
Structure
Synonyms	o-Phenanthroline monohydrate
IUPAC Name	1,10-phenanthroline;hydrate
Molecular Weight	198.22
Molecular Formula	C12H10N2O
Canonical SMILES	C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.O
InChI	PPQJCISYYXZCAE-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H8N2.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-8H;1H2
Boiling Point	365.1 °C at 760 mmHg
Melting Point	100-104 °C-lit.
Purity	98%
Appearance	White crystals or powder
Exact Mass	198.079312947
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	198.079312947
Rotatable Bond Count	0
Topological Polar Surface Area	26.8 Ų

Q&A

What is the CAS number of 1,10-Phenanthroline hydrate?

The CAS number is 5144-89-8.

What is the molecular weight of 1,10-Phenanthroline hydrate?

The molecular weight is 198.22.

How is 1,10-Phenanthroline hydrate stored?

It is sealed in dry, at room temperature.

What is the color of 1,10-Phenanthroline hydrate?

It is off-white, and may become cream-colored during storage.

What are some product categories that 1,10-Phenanthroline hydrate falls under?

It is categorized under Miscellaneous, Analytical Chemistry, Chelating Reagents, Environmentally-friendly Oxidation, Ligands, Phenanthrolines, Synthetic Organic Chemistry, ACS Grade, among others.

How is 1,10-Phenanthroline hydrate used in studying DNA-protein interactions?

When complexed with copper, it possesses nuclease activity that has been used to study DNA-protein interactions.

What are the safety statements associated with 1,10-Phenanthroline hydrate?

The safety statements are 45, 60, and 61.

What are some redox indicators that 1,10-Phenanthroline hydrate can be used for?

It can be used for the spectrophotometric assay of silver and as a photometric reagent for iron.

What is the hazard class associated with 1,10-Phenanthroline hydrate?

The hazard class is 6.1.

What is the main use of 1,10-Phenanthroline monohydrate as a reagent?

It may be used as a chelating agent in the preparation of metal-chelate complexes.