1,10-Phenanthroline-5-carboxylic acid

Catalog Number	ACM630067060-1
CAS	630067-06-0
Structure
Synonyms	5-Carboxy-1,10-phenanthroline
IUPAC Name	1,10-phenanthroline-5-carboxylic acid
Molecular Weight	224.21
Molecular Formula	C13H8N2O2
InChI	UCJSMIWAXWPDOJ-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H8N2O2/c16-13(17)10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H,(H,16,17)
Boiling Point	467.2 °C at 760 mmHg
Melting Point	335-337 °C
Purity	97%
Density	1.431
Complexity	308
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	224.058577502g/mol
Formal Charge	0
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C1=CC2=CC(=C3C=CC=NC3=C2N=C1)C(=O)O
Monoisotopic Mass	224.058577502g/mol
Rotatable Bond Count	1
Topological Polar Surface Area	63.1Ų

Q&A

What is the chemical name of 1,10-Phenanthroline-5-carboxylic acid?

The chemical name of 1,10-Phenanthroline-5-carboxylic acid is 1,10-Phenanthroline-5-carboxylic acid.

What is the molecular weight of 1,10-Phenanthroline-5-carboxylic acid?

The molecular weight of 1,10-Phenanthroline-5-carboxylic acid is 224.21.

Under which category does 1,10-Phenanthroline-5-carboxylic acid fall?

The compound falls under the category of Electronic Chemicals.

What are the synonyms of 1,10-Phenanthroline-5-carboxylic acid?

Some synonyms of 1,10-Phenanthroline-5-carboxylic acid are 1,10-PHENANTHROLINE-5-CARBOXYLICACID630067-06-0, DK7469, 5-carboxylic acid, and 1,10-Phenanthroline-5-carboxylicacid.

What is the molecular formula of 1,10-Phenanthroline-5-carboxylic acid?

The molecular formula of 1,10-Phenanthroline-5-carboxylic acid is C13H8N2O2.

What is the melting point of 1,10-Phenanthroline-5-carboxylic acid?

The melting point of 1,10-Phenanthroline-5-carboxylic acid is 335-337 °C (decomp) when dissolved in methanol.

What is the density of 1,10-Phenanthroline-5-carboxylic acid?

The density of 1,10-Phenanthroline-5-carboxylic acid is 1.431.

What is the pka value of 1,10-Phenanthroline-5-carboxylic acid?

The pka value of 1,10-Phenanthroline-5-carboxylic acid is 1.83±0.30 (Predicted).

What is the predicted boiling point of 1,10-Phenanthroline-5-carboxylic acid?

The predicted boiling point of 1,10-Phenanthroline-5-carboxylic acid is 467.2±30.0 °C.

How should 1,10-Phenanthroline-5-carboxylic acid be stored?

The compound should be stored under inert gas (nitrogen or Argon) at 2-8°C.