1,10-Phenanthroline-5-carbonitrile

Catalog Number	ACM1082219
CAS	1082-21-9
Structure
IUPAC Name	1,10-phenanthroline-5-carbonitrile
Molecular Weight	205.22
Molecular Formula	C13H7N3
InChI	WYVVBWVHLKJJTE-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H7N3/c14-8-10-7-9-3-1-5-15-12(9)13-11(10)4-2-6-16-13/h1-7H
Boiling Point	445.3±25.0 °C(Predicted)
Melting Point	212-213 °C
Purity	98%
Isomeric SMILES	C1=CC2=CC(=C3C=CC=NC3=C2N=C1)C#N

Q&A

What is the CAS number of 1,10-Phenanthroline-5-carbonitrile?

The CAS number of 1,10-Phenanthroline-5-carbonitrile is 1082-21-9.

What is the molecular weight of 1,10-Phenanthroline-5-carbonitrile?

The molecular weight of 1,10-Phenanthroline-5-carbonitrile is 205.21.

What are the synonyms for 1,10-Phenanthroline-5-carbonitrile?

The synonyms for 1,10-Phenanthroline-5-carbonitrile are 1,10-Phenanthroline-5-carbonitrile and 5-Cyano-1,10-phenanthroline.

What is the molecular formula of 1,10-Phenanthroline-5-carbonitrile?

The molecular formula of 1,10-Phenanthroline-5-carbonitrile is C13H7N3.

What is the melting point of 1,10-Phenanthroline-5-carbonitrile?

The melting point of 1,10-Phenanthroline-5-carbonitrile is 212-213 °C.

What is the predicted density of 1,10-Phenanthroline-5-carbonitrile?

The predicted density of 1,10-Phenanthroline-5-carbonitrile is 1.33±0.1 g/cm3.

What is the predicted pka value of 1,10-Phenanthroline-5-carbonitrile?

The predicted pka value of 1,10-Phenanthroline-5-carbonitrile is 3.69±0.10.

What is the predicted boiling point of 1,10-Phenanthroline-5-carbonitrile?

The predicted boiling point of 1,10-Phenanthroline-5-carbonitrile is 445.3±25.0 °C.

How should 1,10-Phenanthroline-5-carbonitrile be stored?

1,10-Phenanthroline-5-carbonitrile should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the chemical structure of 1,10-Phenanthroline-5-carbonitrile?

The chemical structure of 1,10-Phenanthroline-5-carbonitrile can be represented as C13H7N3.