1,10-Phenanthroline-5-carbaldehyde

Catalog Number	ACM91804750
CAS	91804-75-0
Structure
IUPAC Name	1,10-phenanthroline-5-carbaldehyde
Molecular Weight	208.22
Molecular Formula	C13H8N2O
InChI	YKZOGTMQUSLNBU-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H8N2O/c16-8-10-7-9-3-1-5-14-12(9)13-11(10)4-2-6-15-13/h1-8H
Purity	95%
Isomeric SMILES	C1=CC2=CC(=C3C=CC=NC3=C2N=C1)C=O

Q&A

What is the CAS number for 1,10-Phenanthroline-5-carbaldehyde?

The CAS number for 1,10-Phenanthroline-5-carbaldehyde is 91804-75-0.

What is the molecular weight of 1,10-Phenanthroline-5-carbaldehyde?

The molecular weight of 1,10-Phenanthroline-5-carbaldehyde is 208.22.

What are some synonyms for 1,10-Phenanthroline-5-carbaldehyde?

Some synonyms for 1,10-Phenanthroline-5-carbaldehyde are 1,10-Phenanthroline-5-carboxaldehyde and 5-carboxaldehyde.

What is the molecular formula of 1,10-Phenanthroline-5-carbaldehyde?

The molecular formula of 1,10-Phenanthroline-5-carbaldehyde is C13H8N2O.

What is the predicted boiling point of 1,10-Phenanthroline-5-carbaldehyde?

The predicted boiling point of 1,10-Phenanthroline-5-carbaldehyde is 436.1±25.0 °C.

How should 1,10-Phenanthroline-5-carbaldehyde be stored?

1,10-Phenanthroline-5-carbaldehyde should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted density of 1,10-Phenanthroline-5-carbaldehyde?

The predicted density of 1,10-Phenanthroline-5-carbaldehyde is 1.336±0.06 g/cm3.

What is the predicted pka value of 1,10-Phenanthroline-5-carbaldehyde?

The predicted pka value of 1,10-Phenanthroline-5-carbaldehyde is 4.05±0.10.

In what conditions should 1,10-Phenanthroline-5-carbaldehyde be stored?

1,10-Phenanthroline-5-carbaldehyde should be stored under inert gas (nitrogen or Argon) at 2-8°C.