1,10-Phenanthroline-4,7-diol

Catalog Number	ACM3922405-2
CAS	3922-40-5
Structure
Synonyms	4,7-Dihydroxy-1,10-phenanthroline
IUPAC Name	1,10-dihydro-1,10-phenanthroline-4,7-dione
Molecular Weight	212.20
Molecular Formula	C12H8N2O2
Canonical SMILES	C1=CC2=C(C3=C1C(=O)C=CN3)NC=CC2=O
InChI	SLIBCJURSADKPV-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H8N2O2/c15-9-3-5-13-11-7(9)1-2-8-10(16)4-6-14-12(8)11/h1-6H,(H,13,15)(H,14,16)
Boiling Point	515.8±45.0 °C(Predicted)
Melting Point	>300 °C (dec.)-lit.
Purity	97%
Appearance	Yellow powder
Complexity	362
Covalently-Bonded Unit Count	1
EC Number	223-493-6
Exact Mass	212.058577502
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Monoisotopic Mass	212.058577502
Rotatable Bond Count	0
Topological Polar Surface Area	58.2 Ų

Q&A

What is the CAS number of 1,10-Phenanthroline-4,7-diol?

The CAS number is 3922-40-5.

What is the molecular weight of 1,10-Phenanthroline-4,7-diol?

The molecular weight is 212.2.

What is another name for 1,10-Phenanthroline-4,7-diol?

Another name is 4,7-DIHYDROXY-1,10-PHENANTHROLINE.

What is the melting point of 1,10-Phenanthroline-4,7-diol?

The melting point is above 300 °C (dec.).

Is 1,10-Phenanthroline-4,7-diol water-soluble?

No, it is insoluble in water.

What is the color of 1,10-Phenanthroline-4,7-diol?

The color is yellow.

What is the hazard code for 1,10-Phenanthroline-4,7-diol?

The hazard code is Xi.

How is 1,10-Phenanthroline-4,7-diol often utilized in laboratory settings?

It is used as a phenanthroline stain and for the spectrophotometric determination of dissolved oxygen up to 20 ppm.

What is the safety statement associated with 1,10-Phenanthroline-4,7-diol?

The safety statements are 26-36.

Is 1,10-Phenanthroline-4,7-diol hygroscopic?

Yes, it is sensitive and hygroscopic.