1,10-Phenanthroline-4,7-diamine

Catalog Number	ACM119004192
CAS	119004-19-2
IUPAC Name	1,10-phenanthroline-4,7-diamine
Molecular Weight	210.23
Molecular Formula	C12H10N4
InChI	POALUWHJFRTBJA-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H10N4/c13-9-3-5-15-11-7(9)1-2-8-10(14)4-6-16-12(8)11/h1-6H,(H2,13,15)(H2,14,16)
Purity	97%
Isomeric SMILES	C1=CC2=C(C=CN=C2C3=NC=CC(=C31)N)N

Q&A

What is the CAS number for 1,10-Phenanthroline-4,7-diamine?

The CAS number for 1,10-Phenanthroline-4,7-diamine is 119004-19-2.

What is the molecular weight of 1,10-Phenanthroline-4,7-diamine?

The molecular weight of 1,10-Phenanthroline-4,7-diamine is 210.23.

What are the synonyms for 1,10-Phenanthroline-4,7-diamine?

The synonyms for 1,10-Phenanthroline-4,7-diamine are also 1,10-Phenanthroline-4,7-diamine.

What is the molecular formula of 1,10-Phenanthroline-4,7-diamine?

The molecular formula of 1,10-Phenanthroline-4,7-diamine is C12H10N4.

What is the predicted boiling point of 1,10-Phenanthroline-4,7-diamine?

The predicted boiling point of 1,10-Phenanthroline-4,7-diamine is 548.2±45.0 °C.

What is the predicted pka value of 1,10-Phenanthroline-4,7-diamine?

The predicted pka value of 1,10-Phenanthroline-4,7-diamine is 8.87±0.10.

What is the predicted density of 1,10-Phenanthroline-4,7-diamine?

The predicted density of 1,10-Phenanthroline-4,7-diamine is 1.414±0.06 g/cm3.

How is 1,10-Phenanthroline-4,7-diamine represented in chemical formulas?

1,10-Phenanthroline-4,7-diamine is represented as C12H10N4.

How does the predicted boiling point of 1,10-Phenanthroline-4,7-diamine compare to its actual boiling point?

The predicted boiling point may differ from the actual boiling point, but it provides an estimated value for the temperature at which the compound boils.

Why is pka value important in studying the chemical properties of 1,10-Phenanthroline-4,7-diamine?

The pka value indicates the acidity or basicity of a compound, which can affect its chemical reactivity and behavior in reactions.