1,10-Phenanthroline-2-carboxylic acid

Catalog Number	ACM1891174-1
CAS	1891-17-4
Structure
Synonyms	2-Carboxy-1,10-Phenanthroline
IUPAC Name	1,10-phenanthroline-2-carboxylic acid
Molecular Weight	224.22
Molecular Formula	C13H8N2O2
Canonical SMILES	C1=CC2=C(C3=C(C=C2)C=CC(=N3)C(=O)O)N=C1
InChI	MTAHTDBOMUECCQ-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H8N2O2/c16-13(17)10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10/h1-7H,(H,16,17)
Boiling Point	467.2±30.0 °C(Predicted)
Melting Point	209-210 °C
Flash Point	236.3ºC
Purity	98%
Density	1.431g/cm³
Exact Mass	224.05900
Isomeric SMILES	C1=CC2=C(C3=C(C=C2)C=CC(=N3)C(=O)O)N=C1

Q&A

What is the molecular weight of 1,10-Phenanthroline-2-carboxylic acid?

The molecular weight is 224.21.

What are the product categories that 1,10-Phenanthroline-2-carboxylic acid belongs to?

The product categories are MOFS and COFS.

What are the synonyms for 1,10-Phenanthroline-2-carboxylic acid?

The synonyms are 1,10-phenanthroline-2-carboxylic acid; 1,10-Phenanthroline-2-carboxylic acid (7CI, 8CI, 9CI, ACI).

What is the molecular formula of 1,10-Phenanthroline-2-carboxylic acid?

The molecular formula is C13H8N2O2.

What is the melting point of 1,10-Phenanthroline-2-carboxylic acid?

The melting point is 209-210 °C.

What is the predicted density of 1,10-Phenanthroline-2-carboxylic acid?

The predicted density is 1.431±0.06 g/cm3.

What is the predicted pka value of 1,10-Phenanthroline-2-carboxylic acid?

The predicted pka value is 2.49±0.30.

What is the predicted boiling point of 1,10-Phenanthroline-2-carboxylic acid?

The predicted boiling point is 467.2±30.0 °C.

How should 1,10-Phenanthroline-2-carboxylic acid be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the CAS number of 1,10-Phenanthroline-2-carboxylic acid?

The CAS number is 1891-17-4.