1,10-Phenanthroline-2-carbaldehyde

Catalog Number	ACM33795378-2
CAS	33795-37-8
Structure
Synonyms	Pyridino[3,2-H]Quinoline-2-Carbaldehyde; Carbonylphenanthroline
IUPAC Name	1,10-phenanthroline-2-carbaldehyde
Molecular Weight	208.22
Molecular Formula	C13H8N2O
InChI	SURLLZFZRLZTBI-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H8N2O/c16-8-11-6-5-10-4-3-9-2-1-7-14-12(9)13(10)15-11/h1-8H
Boiling Point	152-154 °C
Melting Point	152-154 °C
Purity	97%+
Isomeric SMILES	C1=CC2=C(C3=C(C=C2)C=CC(=N3)C=O)N=C1

Q&A

What is the molecular weight of 1,10-Phenanthroline-2-carbaldehyde?

The molecular weight of 1,10-Phenanthroline-2-carbaldehyde is 208.22.

What are the product categories that 1,10-Phenanthroline-2-carbaldehyde falls under?

1,10-Phenanthroline-2-carbaldehyde falls under MOFS and COFS product categories.

What are some synonyms for 1,10-Phenanthroline-2-carbaldehyde?

Some synonyms for 1,10-Phenanthroline-2-carbaldehyde include 1,10-phenanthroline-2-carboxaldehyde, 2-Formyl-1,10-phenanthroline, and 1,10-phenanthroline-2-carboxyaldehyde.

What is the molecular formula of 1,10-Phenanthroline-2-carbaldehyde?

The molecular formula of 1,10-Phenanthroline-2-carbaldehyde is C13H8N2O.

What is the EINECS number of 1,10-Phenanthroline-2-carbaldehyde?

The EINECS number of 1,10-Phenanthroline-2-carbaldehyde is 1308068-626-2.

What is the predicted melting point of 1,10-Phenanthroline-2-carbaldehyde?

The predicted melting point of 1,10-Phenanthroline-2-carbaldehyde is 152-154℃.

What is the predicted density of 1,10-Phenanthroline-2-carbaldehyde?

The predicted density of 1,10-Phenanthroline-2-carbaldehyde is 1.336±0.06 g/cm3.

What is the predicted pka value of 1,10-Phenanthroline-2-carbaldehyde?

The predicted pka value of 1,10-Phenanthroline-2-carbaldehyde is 4.25±0.10.

What is the predicted boiling point of 1,10-Phenanthroline-2-carbaldehyde?

The predicted boiling point of 1,10-Phenanthroline-2-carbaldehyde is 436.1±25.0 °C.

How should 1,10-Phenanthroline-2-carbaldehyde be stored?

1,10-Phenanthroline-2-carbaldehyde should be stored under inert gas (nitrogen or Argon) at 2-8°C.