1,10-Phenanthrolin-4-ol

Catalog Number	ACM23443314
CAS	23443-31-4
Structure
Synonyms	1H-1,10-Phenanthrolin-4-One
IUPAC Name	1H-1,10-phenanthrolin-4-one
Molecular Weight	196.21
Molecular Formula	C12H8N2O
InChI	IZYBEGHUZQSYII-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H8N2O/c15-10-5-7-14-12-9(10)4-3-8-2-1-6-13-11(8)12/h1-7H,(H,14,15)
Melting Point	214-215 °C
Purity	97%
Isomeric SMILES	C1=CC2=C(C3=C(C=C2)C(=O)C=CN3)N=C1

Q&A

What is the molecular weight of 1,10-Phenanthrolin-4-ol?

The molecular weight of 1,10-Phenanthrolin-4-ol is 196.2.

What are the synonyms for 1,10-Phenanthrolin-4-ol?

The synonyms for 1,10-Phenanthrolin-4-ol are 4-Hydroxy-1,10-phenanthroline and 1H-1,10-phenanthrolin-4-one.

What is the chemical formula of 1,10-Phenanthrolin-4-ol?

The chemical formula of 1,10-Phenanthrolin-4-ol is C12H8N2O.

What is the melting point of 1,10-Phenanthrolin-4-ol?

The melting point of 1,10-Phenanthrolin-4-ol is 214-215℃.

What is the density of 1,10-Phenanthrolin-4-ol?

The predicted density of 1,10-Phenanthrolin-4-ol is 1.376±0.06 g/cm3.

What is the boiling point of 1,10-Phenanthrolin-4-ol?

The predicted boiling point of 1,10-Phenanthrolin-4-ol is 438.6±25.0 °C.

What is the predicted pka value of 1,10-Phenanthrolin-4-ol?

The predicted pka value of 1,10-Phenanthrolin-4-ol is 8.61±0.10.

How would you describe the physical state of 1,10-Phenanthrolin-4-ol at room temperature?

1,10-Phenanthrolin-4-ol is most likely to be in a solid state at room temperature, due to its high melting point.

Why is the boiling point and density of 1,10-Phenanthrolin-4-ol labeled as predicted?

The boiling point and density of 1,10-Phenanthrolin-4-ol are labeled as predicted because they are likely calculated based on the molecular structure and properties of the compound.

How can the pka value of 1,10-Phenanthrolin-4-ol be useful in chemical reactions?

The pka value of 1,10-Phenanthrolin-4-ol can be useful in determining the compound's acidity or basicity, which can affect its reactivity in chemical reactions.