What is the molecular formula of 1,10-Di([1,1':3',1''-terphenyl]-5'-yl)-12-hydroxy-4,5,6,7-tetrahydrodiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide?
The molecular formula of the compound is C53H39O4P.
What is the exact mass of the compound?
The exact mass of the compound is 770.25859672 g/mol.
Can you provide the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1CC23CCC4=C2C(=C(C=C4)C5=CC(=CC(=C5)C6=CC=CC=C6)C7=CC=CC=C7)OP(=O)(OC8=C(C=CC1=C38)C9=CC(=CC(=C9)C1=CC=CC=C1)C1=CC=CC=C1)O.
What is the IUPAC Name of the compound?
The IUPAC Name of the compound is 1,10-bis(3,5-diphenylphenyl)-12-hydroxy-4,5,6,7-tetrahydroiindeno[7,1-de:1',7'-fg][1,3,2]dioxaphosphocine 12-oxide.
How many hydrogen bond acceptors does the compound have?
The compound has 4 hydrogen bond acceptors.
Is there a defined atom stereocenter count for the compound?
No, there are no defined atom stereocenters in the compound.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 13.3.
What is the Monoisotopic Mass of the compound?
The Monoisotopic Mass of the compound is 770.25859672 g/mol.
What is the Depositor-Supplied Synonym for the compound?
One of the Depositor-Supplied Synonyms for the compound is MFCD31747042.
Provide the InChIKey of the compound.
The InChIKey of the compound is FHGPRGRDAJOEBL-UHFFFAOYSA-N.
