1,1'-Ferrocene diboronic acid pinacol ester

Catalog Number	ACM737776931-2
CAS	737776-93-1
Structure
Synonyms	1,1'-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ferrocene
Molecular Weight	437.95
Molecular Formula	C22H32B2FeO4
InChI	QUQAQMAQSCSUAR-UHFFFAOYSA-N
InChI Key	InChI=1S/2C11H16BO2.Fe/c2*1-10(2)11(3,4)14-12(13-10)9-7-5-6-8-9;/h2*5-8H,1-4H3;
Melting Point	191 °C(lit.)
Purity	98%
Appearance	Solid
Isomeric SMILES	B1(OC(C(O1)(C)C)(C)C)[C]2[CH][CH][CH][CH]2.B1(OC(C(O1)(C)C)(C)C)[C]2[CH][CH][CH][CH]2.[Fe]

Q&A

What is the CAS number for 1,1'-Ferrocene diboronic acid pinacol ester?

The CAS number is 737776-93-1.

How many heavy atoms are present in the molecular formula of 1,1'-Ferrocene diboronic acid pinacol ester?

There are 29 heavy atoms in the molecular formula.

What is the exact mass of 1,1'-Ferrocene diboronic acid pinacol ester?

The exact mass is 438.183605.

How many covalently-bonded units are present in 1,1'-Ferrocene diboronic acid pinacol ester?

There are 3 covalently-bonded units.

What is the topological polar surface area of 1,1'-Ferrocene diboronic acid pinacol ester?

The topological polar surface area is 36.9.

Can 1,1'-Ferrocene diboronic acid pinacol ester act as a hydrogen bond donor?

No, it cannot act as a hydrogen bond donor.

What is the name of the compound with the formula C22H32B2FeO4?

The name of the compound is 1,1'-Ferrocene diboronic acid pinacol ester.

What is the molecular weight of 1,1'-Ferrocene diboronic acid pinacol ester?

The molecular weight is 438.0g/mol.

Is there a defined atom stereocenter in the structure of 1,1'-Ferrocene diboronic acid pinacol ester?

No, there is no defined atom stereocenter.

What are some of the synonyms for 1,1'-Ferrocene diboronic acid pinacol ester?

Some synonyms include 1,1'-Ferrocenediboronic acid bis(pinacol) ester, 1,1'-FERROCENEDIBORONIC ACID BIS(PINACOL) ESTER, and AB25234.