What is another name for [1,1'-Binaphthalene]-2,2'-diylbis(diphenylphosphine oxide)?
Another name for it is "Binapo".
What is the CAS number of [1,1'-Binaphthalene]-2,2'-diylbis(diphenylphosphine oxide)?
The CAS number is 86632-33-9.
What is the Canonical SMILES representation of [1,1'-Binaphthalene]-2,2'-diylbis(diphenylphosphine oxide)?
The Canonical SMILES representation is "C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(=O)(C7=CC=CC=C7)C8=CC=CC=C8".
How many covalently-bonded units are in [1,1'-Binaphthalene]-2,2'-diylbis(diphenylphosphine oxide)?
There is 1 covalently-bonded unit.
What is the XLogP3 value of [1,1'-Binaphthalene]-2,2'-diylbis(diphenylphosphine oxide)?
The XLogP3 value is 10.3.
What is the IUPAC Name of [1,1'-Binaphthalene]-2,2'-diylbis(diphenylphosphine oxide)?
The IUPAC Name is "2-diphenylphosphoryl-1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalene".
What is the European Community (EC) Number of [1,1'-Binaphthalene]-2,2'-diylbis(diphenylphosphine oxide)?
The EC Number is 692-505-3.
What is the Molecular Formula of [1,1'-Binaphthalene]-2,2'-diylbis(diphenylphosphine oxide)?
The Molecular Formula is C44H32O2P2.
What is the Molecular Weight of [1,1'-Binaphthalene]-2,2'-diylbis(diphenylphosphine oxide)?
The Molecular Weight is 654.7g/mol.