ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1-(1,10-Phenanthrolin-2-yl)propan-1-one

Catalog Number ACM1227404332
CAS 1227404-33-2
Synonyms 2-propionyl[1,10]phenanthroline
IUPAC Name 1-(1,10-phenanthrolin-2-yl)propan-1-one
Molecular Weight 236.27
Molecular Formula C15H12N2O
InChI WRUYVIQMLRTNJB-UHFFFAOYSA-N
InChI Key InChI=1S/C15H12N2O/c1-2-13(18)12-8-7-11-6-5-10-4-3-9-16-14(10)15(11)17-12/h3-9H,2H2,1H3
Purity 95%+
Isomeric SMILES CCC(=O)C1=NC2=C(C=CC3=C2N=CC=C3)C=C1
Q&A

What is the CAS number for 1-(1,10-Phenanthrolin-2-yl)propan-1-one?

CAS number for 1-(1,10-Phenanthrolin-2-yl)propan-1-one is 1227404-33-2.

What is the molecular weight of 1-(1,10-Phenanthrolin-2-yl)propan-1-one?

The molecular weight of 1-(1,10-Phenanthrolin-2-yl)propan-1-one is 236.27.

What is the other name for 2-propionyl[1,10]phenanthroline?

Another name for 2-propionyl[1,10]phenanthroline is 1-(1,10-Phenanthrolin-2-yl)propan-1-one.

What is the chemical formula for 1-(1,10-Phenanthrolin-2-yl)propan-1-one?

The chemical formula for 1-(1,10-Phenanthrolin-2-yl)propan-1-one is C15H12N2O.

What is the predicted boiling point of 1-(1,10-Phenanthrolin-2-yl)propan-1-one?

The predicted boiling point of 1-(1,10-Phenanthrolin-2-yl)propan-1-one is 422.3±25.0 °C.

What is the predicted pKa of 1-(1,10-Phenanthrolin-2-yl)propan-1-one?

The predicted pKa of 1-(1,10-Phenanthrolin-2-yl)propan-1-one is 4.21±0.10.

What is the predicted density of 1-(1,10-Phenanthrolin-2-yl)propan-1-one?

The predicted density of 1-(1,10-Phenanthrolin-2-yl)propan-1-one is 1.229±0.06 g/cm3.

How is 1-(1,10-Phenanthrolin-2-yl)propan-1-one commonly referred to in the literature?

It is commonly referred to as 2-propionyl[1,10]phenanthroline.

What is the molecular formula of 1-(1,10-Phenanthrolin-2-yl)propan-1-one?

The molecular formula of 1-(1,10-Phenanthrolin-2-yl)propan-1-one is C15H12N2O.

Please kindly note that our products and services are for research use only.